C25H48SSn — CID 176853407
tributyl-[5-(6,6-dimethylheptyl)thiophen-2-yl]stannane (PubChem CID 176853407) has the molecular formula C25H48SSn and a molecular weight of 499.44 g/mol. Its IUPAC name is tributyl-[5-(6,6-dimethylheptyl)thiophen-2-yl]stannane.
| Compound Name | tributyl-[5-(6,6-dimethylheptyl)thiophen-2-yl]stannane |
|---|---|
| PubChem CID | 176853407 |
| Molecular Formula | C25H48SSn |
| Molecular Weight | 499.44 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | tributyl-[5-(6,6-dimethylheptyl)thiophen-2-yl]stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccc(CCCCCC(C)(C)C)s1 |
| InChI | InChI=1S/C13H21S.3C4H9.Sn/c1-13(2,3)10-6-4-5-8-12-9-7-11-14-12;3*1-3-4-2;/h7,9H,4-6,8,10H2,1-3H3;3*1,3-4H2,2H3; |
| InChIKey | KJBXHJSEARBOKK-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.44 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|