C28H42S3Sn — CID 140799576
tributyl-[5-[5-(5-butylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]stannane (PubChem CID 140799576) has the molecular formula C28H42S3Sn and a molecular weight of 593.56 g/mol. Its IUPAC name is tributyl-[5-[5-(5-butylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]stannane.
| Compound Name | tributyl-[5-[5-(5-butylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]stannane |
|---|---|
| PubChem CID | 140799576 |
| Molecular Formula | C28H42S3Sn |
| Molecular Weight | 593.56 g/mol |
| Exact Mass | 594.15 |
| IUPAC Name | tributyl-[5-[5-(5-butylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]stannane |
| SMILES | CCCCc1ccc(-c2ccc(-c3ccc([Sn](CCCC)(CCCC)CCCC)s3)s2)s1 |
| InChI | InChI=1S/C16H15S3.3C4H9.Sn/c1-2-3-5-12-7-8-15(18-12)16-10-9-14(19-16)13-6-4-11-17-13;3*1-3-4-2;/h4,6-10H,2-3,5H2,1H3;3*1,3-4H2,2H3; |
| InChIKey | PYFPRNVWEWTYMZ-UHFFFAOYSA-N |
| XLogP | 10.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.56 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |