C37H43N3S4 — CID 157191931
(2E,4E)-N,N-diethyl-5-[5-[7-[5-[5-(2-ethylhexyl)thiophen-2-yl]thiophen-2-yl]-2,1,3-benzothiadiazol-4-yl]thiophen-2-yl]hepta-2,4,6-trien-2-amine (PubChem CID 157191931) has the molecular formula C37H43N3S4 and a molecular weight of 658.04 g/mol. Its IUPAC name is (2E,4E)-N,N-diethyl-5-[5-[7-[5-[5-(2-ethylhexyl)thiophen-2-yl]thiophen-2-yl]-2,1,3-benzothiadiazol-4-yl]thiophen-2-yl]hepta-2,4,6-trien-2-amine.
| Compound Name | (2E,4E)-N,N-diethyl-5-[5-[7-[5-[5-(2-ethylhexyl)thiophen-2-yl]thiophen-2-yl]-2,1,3-benzothiadiazol-4-yl]thiophen-2-yl]hepta-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 157191931 |
| Molecular Formula | C37H43N3S4 |
| Molecular Weight | 658.04 g/mol |
| Exact Mass | 657.23 |
| IUPAC Name | (2E,4E)-N,N-diethyl-5-[5-[7-[5-[5-(2-ethylhexyl)thiophen-2-yl]thiophen-2-yl]-2,1,3-benzothiadiazol-4-yl]thiophen-2-yl]hepta-2,4,6-trien-2-amine |
| SMILES | C=C/C(=C\C=C(/C)N(CC)CC)c1ccc(-c2ccc(-c3ccc(-c4ccc(CC(CC)CCCC)s4)s3)c3nsnc23)s1 |
| InChI | InChI=1S/C37H43N3S4/c1-7-12-13-26(8-2)24-28-16-19-34(41-28)35-23-22-33(43-35)30-18-17-29(36-37(30)39-44-38-36)32-21-20-31(42-32)27(9-3)15-14-25(6)40(10-4)11-5/h9,14-23,26H,3,7-8,10-13,24H2,1-2,4-6H3/b25-14+,27-15+ |
| InChIKey | HRKOUSVZICMJJV-GTJUSSHHSA-N |
| XLogP | 12.45 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.04 |
| LogP ≤ 5 | 12.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|