C33H30F2N2S3 — CID 155032635
4-[5-[(3E,5E)-5-fluorododeca-1,3,5-trien-4-yl]thiophen-2-yl]-7-[5-(2-fluoro-4-methylphenyl)thiophen-2-yl]-2,1,3-benzothiadiazole (PubChem CID 155032635) has the molecular formula C33H30F2N2S3 and a molecular weight of 588.81 g/mol. Its IUPAC name is 4-[5-[(3E,5E)-5-fluorododeca-1,3,5-trien-4-yl]thiophen-2-yl]-7-[5-(2-fluoro-4-methylphenyl)thiophen-2-yl]-2,1,3-benzothiadiazole.
| Compound Name | 4-[5-[(3E,5E)-5-fluorododeca-1,3,5-trien-4-yl]thiophen-2-yl]-7-[5-(2-fluoro-4-methylphenyl)thiophen-2-yl]-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 155032635 |
| Molecular Formula | C33H30F2N2S3 |
| Molecular Weight | 588.81 g/mol |
| Exact Mass | 588.15 |
| IUPAC Name | 4-[5-[(3E,5E)-5-fluorododeca-1,3,5-trien-4-yl]thiophen-2-yl]-7-[5-(2-fluoro-4-methylphenyl)thiophen-2-yl]-2,1,3-benzothiadiazole |
| SMILES | C=C/C=C(C(\F)=C/CCCCCC)/c1ccc(-c2ccc(-c3ccc(-c4ccc(C)cc4F)s3)c3nsnc23)s1 |
| InChI | InChI=1S/C33H30F2N2S3/c1-4-6-7-8-9-11-26(34)22(10-5-2)28-16-18-30(38-28)24-14-15-25(33-32(24)36-40-37-33)31-19-17-29(39-31)23-13-12-21(3)20-27(23)35/h5,10-20H,2,4,6-9H2,1,3H3/b22-10+,26-11+ |
| InChIKey | ZYPOVNDOVVIVAJ-SETCCFJLSA-N |
| XLogP | 11.66 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.81 |
| LogP ≤ 5 | 11.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|