C23H37FS — CID 147418388
3-(2-ethylhexyl)-5-(3-fluorobuta-1,3-dien-2-yl)-2-(2,3,3-trimethylbutan-2-yl)thiophene (PubChem CID 147418388) has the molecular formula C23H37FS and a molecular weight of 364.61 g/mol. Its IUPAC name is 3-(2-ethylhexyl)-5-(3-fluorobuta-1,3-dien-2-yl)-2-(2,3,3-trimethylbutan-2-yl)thiophene.
| Compound Name | 3-(2-ethylhexyl)-5-(3-fluorobuta-1,3-dien-2-yl)-2-(2,3,3-trimethylbutan-2-yl)thiophene |
|---|---|
| PubChem CID | 147418388 |
| Molecular Formula | C23H37FS |
| Molecular Weight | 364.61 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | 3-(2-ethylhexyl)-5-(3-fluorobuta-1,3-dien-2-yl)-2-(2,3,3-trimethylbutan-2-yl)thiophene |
| SMILES | C=C(F)C(=C)c1cc(CC(CC)CCCC)c(C(C)(C)C(C)(C)C)s1 |
| InChI | InChI=1S/C23H37FS/c1-10-12-13-18(11-2)14-19-15-20(16(3)17(4)24)25-21(19)23(8,9)22(5,6)7/h15,18H,3-4,10-14H2,1-2,5-9H3 |
| InChIKey | DRZHEWIDFNCXGM-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.61 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|