C28H42 — CID 94865694
1,4-bis[(2R)-2-ethylhexyl]-2,5-bis(prop-1-ynyl)benzene (PubChem CID 94865694) has the molecular formula C28H42 and a molecular weight of 378.64 g/mol. Its IUPAC name is 1,4-bis[(2R)-2-ethylhexyl]-2,5-bis(prop-1-ynyl)benzene.
| Compound Name | 1,4-bis[(2R)-2-ethylhexyl]-2,5-bis(prop-1-ynyl)benzene |
|---|---|
| PubChem CID | 94865694 |
| Molecular Formula | C28H42 |
| Molecular Weight | 378.64 g/mol |
| Exact Mass | 378.33 |
| IUPAC Name | 1,4-bis[(2R)-2-ethylhexyl]-2,5-bis(prop-1-ynyl)benzene |
| SMILES | CC#Cc1cc(C[C@H](CC)CCCC)c(C#CC)cc1C[C@H](CC)CCCC |
| InChI | InChI=1S/C28H42/c1-7-13-17-23(11-5)19-27-21-26(16-10-4)28(22-25(27)15-9-3)20-24(12-6)18-14-8-2/h21-24H,7-8,11-14,17-20H2,1-6H3/t23-,24-/m1/s1 |
| InChIKey | CWDFKLNDSGZYPM-DNQXCXABSA-N |
| XLogP | 7.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.64 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|