C31H53NO — CID 89120471
1,3,5-tris(2-ethylhexyl)-2-isocyanatobenzene (PubChem CID 89120471) has the molecular formula C31H53NO and a molecular weight of 455.77 g/mol. Its IUPAC name is 1,3,5-tris(2-ethylhexyl)-2-isocyanatobenzene.
| Compound Name | 1,3,5-tris(2-ethylhexyl)-2-isocyanatobenzene |
|---|---|
| PubChem CID | 89120471 |
| Molecular Formula | C31H53NO |
| Molecular Weight | 455.77 g/mol |
| Exact Mass | 455.41 |
| IUPAC Name | 1,3,5-tris(2-ethylhexyl)-2-isocyanatobenzene |
| SMILES | CCCCC(CC)Cc1cc(CC(CC)CCCC)c(N=C=O)c(CC(CC)CCCC)c1 |
| InChI | InChI=1S/C31H53NO/c1-7-13-16-25(10-4)19-28-22-29(20-26(11-5)17-14-8-2)31(32-24-33)30(23-28)21-27(12-6)18-15-9-3/h22-23,25-27H,7-21H2,1-6H3 |
| InChIKey | XHJGITNORBOLFD-UHFFFAOYSA-N |
| XLogP | 9.93 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.77 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|