C32H54F2S2 — CID 161413143
5-tert-butyl-2-(2-ethylhexyl)-3-fluorothiophene;5-tert-butyl-3-fluoro-2-octylthiophene (PubChem CID 161413143) has the molecular formula C32H54F2S2 and a molecular weight of 540.91 g/mol. Its IUPAC name is 5-tert-butyl-2-(2-ethylhexyl)-3-fluorothiophene;5-tert-butyl-3-fluoro-2-octylthiophene.
| Compound Name | 5-tert-butyl-2-(2-ethylhexyl)-3-fluorothiophene;5-tert-butyl-3-fluoro-2-octylthiophene |
|---|---|
| PubChem CID | 161413143 |
| Molecular Formula | C32H54F2S2 |
| Molecular Weight | 540.91 g/mol |
| Exact Mass | 540.36 |
| IUPAC Name | 5-tert-butyl-2-(2-ethylhexyl)-3-fluorothiophene;5-tert-butyl-3-fluoro-2-octylthiophene |
| SMILES | CCCCC(CC)Cc1sc(C(C)(C)C)cc1F.CCCCCCCCc1sc(C(C)(C)C)cc1F |
| InChI | InChI=1S/2C16H27FS/c1-6-8-9-12(7-2)10-14-13(17)11-15(18-14)16(3,4)5;1-5-6-7-8-9-10-11-14-13(17)12-15(18-14)16(2,3)4/h11-12H,6-10H2,1-5H3;12H,5-11H2,1-4H3 |
| InChIKey | VVSWUFAJEMBGCA-UHFFFAOYSA-N |
| XLogP | 12.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.91 |
| LogP ≤ 5 | 12.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|