C20H32S2 — CID 122397780
5-(2-ethylhexyl)-6-hexylthieno[3,2-b]thiophene (PubChem CID 122397780) has the molecular formula C20H32S2 and a molecular weight of 336.61 g/mol. Its IUPAC name is 5-(2-ethylhexyl)-6-hexylthieno[3,2-b]thiophene.
| Compound Name | 5-(2-ethylhexyl)-6-hexylthieno[3,2-b]thiophene |
|---|---|
| PubChem CID | 122397780 |
| Molecular Formula | C20H32S2 |
| Molecular Weight | 336.61 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | 5-(2-ethylhexyl)-6-hexylthieno[3,2-b]thiophene |
| SMILES | CCCCCCc1c(CC(CC)CCCC)sc2ccsc12 |
| InChI | InChI=1S/C20H32S2/c1-4-7-9-10-12-17-19(15-16(6-3)11-8-5-2)22-18-13-14-21-20(17)18/h13-14,16H,4-12,15H2,1-3H3 |
| InChIKey | LWJAAEWYDBHSPH-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.61 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|