C12H15BrS2 — CID 122397779
5-bromo-6-hexylthieno[3,2-b]thiophene (PubChem CID 122397779) has the molecular formula C12H15BrS2 and a molecular weight of 303.29 g/mol. Its IUPAC name is 5-bromo-6-hexylthieno[3,2-b]thiophene.
| Compound Name | 5-bromo-6-hexylthieno[3,2-b]thiophene |
|---|---|
| PubChem CID | 122397779 |
| Molecular Formula | C12H15BrS2 |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 301.98 |
| IUPAC Name | 5-bromo-6-hexylthieno[3,2-b]thiophene |
| SMILES | CCCCCCc1c(Br)sc2ccsc12 |
| InChI | InChI=1S/C12H15BrS2/c1-2-3-4-5-6-9-11-10(7-8-14-11)15-12(9)13/h7-8H,2-6H2,1H3 |
| InChIKey | MLSKDKVGFJGFHI-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|