C15H20OS2 — CID 141420068
6-octylthieno[3,2-b]thiophene-5-carbaldehyde (PubChem CID 141420068) has the molecular formula C15H20OS2 and a molecular weight of 280.46 g/mol. Its IUPAC name is 6-octylthieno[3,2-b]thiophene-5-carbaldehyde.
| Compound Name | 6-octylthieno[3,2-b]thiophene-5-carbaldehyde |
|---|---|
| PubChem CID | 141420068 |
| Molecular Formula | C15H20OS2 |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 6-octylthieno[3,2-b]thiophene-5-carbaldehyde |
| SMILES | CCCCCCCCc1c(C=O)sc2ccsc12 |
| InChI | InChI=1S/C15H20OS2/c1-2-3-4-5-6-7-8-12-14(11-16)18-13-9-10-17-15(12)13/h9-11H,2-8H2,1H3 |
| InChIKey | PSFTWWYMPNWKBH-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|