C32H54S2Si — CID 140665635
4,10-ditert-butyl-7,7-bis(2-ethylhexyl)-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene (PubChem CID 140665635) has the molecular formula C32H54S2Si and a molecular weight of 531.00 g/mol. Its IUPAC name is 4,10-ditert-butyl-7,7-bis(2-ethylhexyl)-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene.
| Compound Name | 4,10-ditert-butyl-7,7-bis(2-ethylhexyl)-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
|---|---|
| PubChem CID | 140665635 |
| Molecular Formula | C32H54S2Si |
| Molecular Weight | 531.00 g/mol |
| Exact Mass | 530.34 |
| IUPAC Name | 4,10-ditert-butyl-7,7-bis(2-ethylhexyl)-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
| SMILES | CCCCC(CC)C[Si]1(CC(CC)CCCC)c2cc(C(C)(C)C)sc2-c2sc(C(C)(C)C)cc21 |
| InChI | InChI=1S/C32H54S2Si/c1-11-15-17-23(13-3)21-35(22-24(14-4)18-16-12-2)25-19-27(31(5,6)7)33-29(25)30-26(35)20-28(34-30)32(8,9)10/h19-20,23-24H,11-18,21-22H2,1-10H3 |
| InChIKey | NZDDMPVVHYVWLD-UHFFFAOYSA-N |
| XLogP | 10.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.00 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|