C27H44S2Si — CID 123407748
7-(2-butyloctyl)-4,10-dimethyl-7-pentyl-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene (PubChem CID 123407748) has the molecular formula C27H44S2Si and a molecular weight of 460.87 g/mol. Its IUPAC name is 7-(2-butyloctyl)-4,10-dimethyl-7-pentyl-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene.
| Compound Name | 7-(2-butyloctyl)-4,10-dimethyl-7-pentyl-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
|---|---|
| PubChem CID | 123407748 |
| Molecular Formula | C27H44S2Si |
| Molecular Weight | 460.87 g/mol |
| Exact Mass | 460.27 |
| IUPAC Name | 7-(2-butyloctyl)-4,10-dimethyl-7-pentyl-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
| SMILES | CCCCCCC(CCCC)C[Si]1(CCCCC)c2cc(C)sc2-c2sc(C)cc21 |
| InChI | InChI=1S/C27H44S2Si/c1-6-9-12-13-16-23(15-11-8-3)20-30(17-14-10-7-2)24-18-21(4)28-26(24)27-25(30)19-22(5)29-27/h18-19,23H,6-17,20H2,1-5H3 |
| InChIKey | YGFXNXZGSZEXAW-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.87 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|