C39H60S2Si — CID 123313827
7-(4-heptylphenyl)-7-(2-hexyldecyl)-4,10-dimethyl-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene (PubChem CID 123313827) has the molecular formula C39H60S2Si and a molecular weight of 621.13 g/mol. Its IUPAC name is 7-(4-heptylphenyl)-7-(2-hexyldecyl)-4,10-dimethyl-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene.
| Compound Name | 7-(4-heptylphenyl)-7-(2-hexyldecyl)-4,10-dimethyl-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
|---|---|
| PubChem CID | 123313827 |
| Molecular Formula | C39H60S2Si |
| Molecular Weight | 621.13 g/mol |
| Exact Mass | 620.39 |
| IUPAC Name | 7-(4-heptylphenyl)-7-(2-hexyldecyl)-4,10-dimethyl-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
| SMILES | CCCCCCCCC(CCCCCC)C[Si]1(c2ccc(CCCCCCC)cc2)c2cc(C)sc2-c2sc(C)cc21 |
| InChI | InChI=1S/C39H60S2Si/c1-6-9-12-15-17-20-23-34(22-18-14-11-8-3)30-42(35-26-24-33(25-27-35)21-19-16-13-10-7-2)36-28-31(4)40-38(36)39-37(42)29-32(5)41-39/h24-29,34H,6-23,30H2,1-5H3 |
| InChIKey | BMOQNQVLZQQIKR-UHFFFAOYSA-N |
| XLogP | 11.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.13 |
| LogP ≤ 5 | 11.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|