C34H47NO2S3Si — CID 102455331
3-[7,7-bis(2-ethylhexyl)-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-5-butylthieno[3,4-c]pyrrole-4,6-dione (PubChem CID 102455331) has the molecular formula C34H47NO2S3Si and a molecular weight of 626.04 g/mol. Its IUPAC name is 3-[7,7-bis(2-ethylhexyl)-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-5-butylthieno[3,4-c]pyrrole-4,6-dione.
| Compound Name | 3-[7,7-bis(2-ethylhexyl)-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-5-butylthieno[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 102455331 |
| Molecular Formula | C34H47NO2S3Si |
| Molecular Weight | 626.04 g/mol |
| Exact Mass | 625.25 |
| IUPAC Name | 3-[7,7-bis(2-ethylhexyl)-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-5-butylthieno[3,4-c]pyrrole-4,6-dione |
| SMILES | CCCCC(CC)C[Si]1(CC(CC)CCCC)c2ccsc2-c2sc(-c3scc4c3C(=O)N(CCCC)C4=O)cc21 |
| InChI | InChI=1S/C34H47NO2S3Si/c1-6-11-14-23(9-4)21-41(22-24(10-5)15-12-7-2)27-16-18-38-31(27)32-28(41)19-26(40-32)30-29-25(20-39-30)33(36)35(34(29)37)17-13-8-3/h16,18-20,23-24H,6-15,17,21-22H2,1-5H3 |
| InChIKey | OVRDTZBPKOMFCS-UHFFFAOYSA-N |
| XLogP | 9.91 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.04 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|