C36H47NO3S3Si — CID 90363248
3-[7,7-bis(2-ethylhexyl)-10-methyl-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-1-methyl-5-[(E)-3-oxobut-1-enyl]thieno[3,4-c]pyrrole-4,6-dione (PubChem CID 90363248) has the molecular formula C36H47NO3S3Si and a molecular weight of 666.06 g/mol. Its IUPAC name is 3-[7,7-bis(2-ethylhexyl)-10-methyl-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-1-methyl-5-[(E)-3-oxobut-1-enyl]thieno[3,4-c]pyrrole-4,6-dione.
| Compound Name | 3-[7,7-bis(2-ethylhexyl)-10-methyl-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-1-methyl-5-[(E)-3-oxobut-1-enyl]thieno[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 90363248 |
| Molecular Formula | C36H47NO3S3Si |
| Molecular Weight | 666.06 g/mol |
| Exact Mass | 665.25 |
| IUPAC Name | 3-[7,7-bis(2-ethylhexyl)-10-methyl-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-1-methyl-5-[(E)-3-oxobut-1-enyl]thieno[3,4-c]pyrrole-4,6-dione |
| SMILES | CCCCC(CC)C[Si]1(CC(CC)CCCC)c2cc(C)sc2-c2sc(-c3sc(C)c4c3C(=O)N(/C=C/C(C)=O)C4=O)cc21 |
| InChI | InChI=1S/C36H47NO3S3Si/c1-8-12-14-25(10-3)20-44(21-26(11-4)15-13-9-2)28-18-23(6)41-33(28)34-29(44)19-27(43-34)32-31-30(24(7)42-32)35(39)37(36(31)40)17-16-22(5)38/h16-19,25-26H,8-15,20-21H2,1-7H3/b17-16+ |
| InChIKey | BJFDYVRKPAOHCP-WUKNDPDISA-N |
| XLogP | 9.83 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.06 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|