C44H61N — CID 130398300
6-tert-butyl-4,8-bis(2-ethylhexyl)-N,N-bis(4-methylphenyl)naphthalen-2-amine (PubChem CID 130398300) has the molecular formula C44H61N and a molecular weight of 603.98 g/mol. Its IUPAC name is 6-tert-butyl-4,8-bis(2-ethylhexyl)-N,N-bis(4-methylphenyl)naphthalen-2-amine.
| Compound Name | 6-tert-butyl-4,8-bis(2-ethylhexyl)-N,N-bis(4-methylphenyl)naphthalen-2-amine |
|---|---|
| PubChem CID | 130398300 |
| Molecular Formula | C44H61N |
| Molecular Weight | 603.98 g/mol |
| Exact Mass | 603.48 |
| IUPAC Name | 6-tert-butyl-4,8-bis(2-ethylhexyl)-N,N-bis(4-methylphenyl)naphthalen-2-amine |
| SMILES | CCCCC(CC)Cc1cc(C(C)(C)C)cc2c(CC(CC)CCCC)cc(N(c3ccc(C)cc3)c3ccc(C)cc3)cc12 |
| InChI | InChI=1S/C44H61N/c1-10-14-16-34(12-3)26-36-28-38(44(7,8)9)30-42-37(27-35(13-4)17-15-11-2)29-41(31-43(36)42)45(39-22-18-32(5)19-23-39)40-24-20-33(6)21-25-40/h18-25,28-31,34-35H,10-17,26-27H2,1-9H3 |
| InChIKey | JWAFUSPMBLLDCT-UHFFFAOYSA-N |
| XLogP | 13.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.98 |
| LogP ≤ 5 | 13.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |