C66H90 — CID 123153198
3-[4,8-bis(2-ethylhexyl)-7-methylnaphthalen-2-yl]-1,5-bis(3,5-ditert-butylphenyl)-7-methylnaphthalene (PubChem CID 123153198) has the molecular formula C66H90 and a molecular weight of 883.45 g/mol. Its IUPAC name is 3-[4,8-bis(2-ethylhexyl)-7-methylnaphthalen-2-yl]-1,5-bis(3,5-ditert-butylphenyl)-7-methylnaphthalene.
| Compound Name | 3-[4,8-bis(2-ethylhexyl)-7-methylnaphthalen-2-yl]-1,5-bis(3,5-ditert-butylphenyl)-7-methylnaphthalene |
|---|---|
| PubChem CID | 123153198 |
| Molecular Formula | C66H90 |
| Molecular Weight | 883.45 g/mol |
| Exact Mass | 882.70 |
| IUPAC Name | 3-[4,8-bis(2-ethylhexyl)-7-methylnaphthalen-2-yl]-1,5-bis(3,5-ditert-butylphenyl)-7-methylnaphthalene |
| SMILES | CCCCC(CC)Cc1cc(-c2cc(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)c3cc(C)cc(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c3c2)cc2c(CC(CC)CCCC)c(C)ccc12 |
| InChI | InChI=1S/C66H90/c1-19-23-25-45(21-3)31-49-33-47(39-61-56(49)28-27-44(6)57(61)32-46(22-4)26-24-20-2)48-38-59(51-36-54(65(13,14)15)42-55(37-51)66(16,17)18)60-30-43(5)29-58(62(60)40-48)50-34-52(63(7,8)9)41-53(35-50)64(10,11)12/h27-30,33-42,45-46H,19-26,31-32H2,1-18H3 |
| InChIKey | VOQLSCWOCZTGLG-UHFFFAOYSA-N |
| XLogP | 20.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.45 |
| LogP ≤ 5 | 20.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |