C44H50N4OS3 — CID 134195684
2,8-bis[5-[4-(3-ethylheptyl)phenyl]thiophen-2-yl]-5-oxa-11λ4-thia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1,3,6,8,10,11-hexaene (PubChem CID 134195684) has the molecular formula C44H50N4OS3 and a molecular weight of 747.11 g/mol. Its IUPAC name is 2,8-bis[5-[4-(3-ethylheptyl)phenyl]thiophen-2-yl]-5-oxa-11λ4-thia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1,3,6,8,10,11-hexaene.
| Compound Name | 2,8-bis[5-[4-(3-ethylheptyl)phenyl]thiophen-2-yl]-5-oxa-11λ4-thia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1,3,6,8,10,11-hexaene |
|---|---|
| PubChem CID | 134195684 |
| Molecular Formula | C44H50N4OS3 |
| Molecular Weight | 747.11 g/mol |
| Exact Mass | 746.31 |
| IUPAC Name | 2,8-bis[5-[4-(3-ethylheptyl)phenyl]thiophen-2-yl]-5-oxa-11λ4-thia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1,3,6,8,10,11-hexaene |
| SMILES | CCCCC(CC)CCc1ccc(-c2ccc(-c3c4c(c(-c5ccc(-c6ccc(CCC(CC)CCCC)cc6)s5)c5nonc35)N=S=N4)s2)cc1 |
| InChI | InChI=1S/C44H50N4OS3/c1-5-9-11-29(7-3)13-15-31-17-21-33(22-18-31)35-25-27-37(50-35)39-41-42(46-49-45-41)40(44-43(39)47-52-48-44)38-28-26-36(51-38)34-23-19-32(20-24-34)16-14-30(8-4)12-10-6-2/h17-30H,5-16H2,1-4H3 |
| InChIKey | QHXOAYBQJCAZNK-UHFFFAOYSA-N |
| XLogP | 15.04 |
| TPSA | 63.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.11 |
| LogP ≤ 5 | 15.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |