C32H32N2S2 — CID 59488717
2,6-bis[5-(4-butylphenyl)thiophen-2-yl]pyrazine (PubChem CID 59488717) has the molecular formula C32H32N2S2 and a molecular weight of 508.76 g/mol. Its IUPAC name is 2,6-bis[5-(4-butylphenyl)thiophen-2-yl]pyrazine.
| Compound Name | 2,6-bis[5-(4-butylphenyl)thiophen-2-yl]pyrazine |
|---|---|
| PubChem CID | 59488717 |
| Molecular Formula | C32H32N2S2 |
| Molecular Weight | 508.76 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | 2,6-bis[5-(4-butylphenyl)thiophen-2-yl]pyrazine |
| SMILES | CCCCc1ccc(-c2ccc(-c3cncc(-c4ccc(-c5ccc(CCCC)cc5)s4)n3)s2)cc1 |
| InChI | InChI=1S/C32H32N2S2/c1-3-5-7-23-9-13-25(14-10-23)29-17-19-31(35-29)27-21-33-22-28(34-27)32-20-18-30(36-32)26-15-11-24(12-16-26)8-6-4-2/h9-22H,3-8H2,1-2H3 |
| InChIKey | ROSPTVANDZOEBE-UHFFFAOYSA-N |
| XLogP | 9.95 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.76 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |