C26H28P2S2 — CID 59207297
3-[4-[5-[5-[4-(3-phosphanylpropyl)phenyl]thiophen-2-yl]thiophen-2-yl]phenyl]propylphosphane (PubChem CID 59207297) has the molecular formula C26H28P2S2 and a molecular weight of 466.59 g/mol. Its IUPAC name is 3-[4-[5-[5-[4-(3-phosphanylpropyl)phenyl]thiophen-2-yl]thiophen-2-yl]phenyl]propylphosphane.
| Compound Name | 3-[4-[5-[5-[4-(3-phosphanylpropyl)phenyl]thiophen-2-yl]thiophen-2-yl]phenyl]propylphosphane |
|---|---|
| PubChem CID | 59207297 |
| Molecular Formula | C26H28P2S2 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | 3-[4-[5-[5-[4-(3-phosphanylpropyl)phenyl]thiophen-2-yl]thiophen-2-yl]phenyl]propylphosphane |
| SMILES | PCCCc1ccc(-c2ccc(-c3ccc(-c4ccc(CCCP)cc4)s3)s2)cc1 |
| InChI | InChI=1S/C26H28P2S2/c27-17-1-3-19-5-9-21(10-6-19)23-13-15-25(29-23)26-16-14-24(30-26)22-11-7-20(8-12-22)4-2-18-28/h5-16H,1-4,17-18,27-28H2 |
| InChIKey | GCXUSHCLXZCYRE-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|