C48H48N2S2 — CID 59682226
1-N,4-N-bis(4-butylphenyl)-1-N,4-N-bis[4-(5-methylthiophen-2-yl)phenyl]benzene-1,4-diamine (PubChem CID 59682226) has the molecular formula C48H48N2S2 and a molecular weight of 717.06 g/mol. Its IUPAC name is 1-N,4-N-bis(4-butylphenyl)-1-N,4-N-bis[4-(5-methylthiophen-2-yl)phenyl]benzene-1,4-diamine.
| Compound Name | 1-N,4-N-bis(4-butylphenyl)-1-N,4-N-bis[4-(5-methylthiophen-2-yl)phenyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 59682226 |
| Molecular Formula | C48H48N2S2 |
| Molecular Weight | 717.06 g/mol |
| Exact Mass | 716.33 |
| IUPAC Name | 1-N,4-N-bis(4-butylphenyl)-1-N,4-N-bis[4-(5-methylthiophen-2-yl)phenyl]benzene-1,4-diamine |
| SMILES | CCCCc1ccc(N(c2ccc(-c3ccc(C)s3)cc2)c2ccc(N(c3ccc(CCCC)cc3)c3ccc(-c4ccc(C)s4)cc3)cc2)cc1 |
| InChI | InChI=1S/C48H48N2S2/c1-5-7-9-37-13-21-41(22-14-37)49(43-25-17-39(18-26-43)47-33-11-35(3)51-47)45-29-31-46(32-30-45)50(42-23-15-38(16-24-42)10-8-6-2)44-27-19-40(20-28-44)48-34-12-36(4)52-48/h11-34H,5-10H2,1-4H3 |
| InChIKey | IQOCQRAMABMVKE-UHFFFAOYSA-N |
| XLogP | 15.39 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.06 |
| LogP ≤ 5 | 15.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |