About CID 89216957
CID 89216957 (PubChem CID 89216957) has the molecular formula C68H69BN4
and a molecular weight of 953.14 g/mol.
Molecular Properties
| Compound Name | CID 89216957 |
| PubChem CID | 89216957 |
| Molecular Formula | C68H69BN4 |
| Molecular Weight | 953.14 g/mol |
| Exact Mass | 952.56 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(N(c2ccc(CCCC)cc2)c2ccc(N(c3ccc(C)cc3)c3ccc(N(c4ccc(CCCC)cc4)c4ccc(N(c5ccc(C)cc5)c5ccc(CCCC)cc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C68H69BN4/c1-6-9-12-53-19-31-59(32-20-53)70(57-27-15-51(4)16-28-57)63-39-47-67(48-40-63)73(61-35-23-55(24-36-61)14-11-8-3)68-49-43-65(44-50-68)71(58-29-17-52(5)18-30-58)64-41-45-66(46-42-64)72(62-37-25-56(69)26-38-62)60-33-21-54(22-34-60)13-10-7-2/h15-50H,6-14H2,1-5H3 |
| InChIKey | PVFKFLUAMBAJBC-UHFFFAOYSA-N |
| XLogP | 19.00 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 73 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 953.14 |
| LogP ≤ 5 | 19.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 89216957 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89216957?
The IUPAC name of CID 89216957 (CID 89216957) is not available.
What is the SMILES notation for CID 89216957?
The canonical SMILES for CID 89216957 is [B]c1ccc(N(c2ccc(CCCC)cc2)c2ccc(N(c3ccc(C)cc3)c3ccc(N(c4ccc(CCCC)cc4)c4ccc(N(c5ccc(C)cc5)c5ccc(CCCC)cc5)cc4)cc3)cc2)cc1.
What is the InChIKey of CID 89216957?
The InChIKey is PVFKFLUAMBAJBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C68H69BN4/c1-6-9-12-53-19-31-59(32-20-53)70(57-27-15-51(4)16-28-57)63-39-47-67(48-40-63)73(61-35-23-55(24-36-61)14-11-8-3)68-49-43-65(44-50-68)71(58-29-17-52(5)18-30-58)64-41-45-66(46-42-64)72(62-37-25-56(69)26-38-62)60-33-21-54(22-34-60)13-10-7-2/h15-50H,6-14H2,1-5H3.
What are the key properties of CID 89216957?
CID 89216957 has a molecular weight of 953.14 g/mol, XLogP of 19.00, 21 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89216957 is sourced from PubChem (CID 89216957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).