C40H43BN2 — CID 89038222
CID 89038222 (PubChem CID 89038222) has the molecular formula C40H43BN2 and a molecular weight of 562.61 g/mol.
| Compound Name | CID 89038222 |
|---|---|
| PubChem CID | 89038222 |
| Molecular Formula | C40H43BN2 |
| Molecular Weight | 562.61 g/mol |
| Exact Mass | 562.35 |
| IUPAC Name | — |
| SMILES | [B]c1cc(C)c(N(c2ccc(C)cc2)c2ccc(N(c3ccc(C)cc3)c3c(C)cc(CCCC)cc3C)cc2)c(C)c1 |
| InChI | InChI=1S/C40H43BN2/c1-8-9-10-33-23-29(4)39(30(5)24-33)42(35-15-11-27(2)12-16-35)37-19-21-38(22-20-37)43(36-17-13-28(3)14-18-36)40-31(6)25-34(41)26-32(40)7/h11-26H,8-10H2,1-7H3 |
| InChIKey | PUZSPFALIBOETP-UHFFFAOYSA-N |
| XLogP | 10.61 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.61 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|