C61H69N — CID 144813748
N,N-bis[3-(4-hexylphenyl)-4-methyl-5-(4-methylphenyl)phenyl]-2,4,6-trimethylaniline (PubChem CID 144813748) has the molecular formula C61H69N and a molecular weight of 816.23 g/mol. Its IUPAC name is N,N-bis[3-(4-hexylphenyl)-4-methyl-5-(4-methylphenyl)phenyl]-2,4,6-trimethylaniline.
| Compound Name | N,N-bis[3-(4-hexylphenyl)-4-methyl-5-(4-methylphenyl)phenyl]-2,4,6-trimethylaniline |
|---|---|
| PubChem CID | 144813748 |
| Molecular Formula | C61H69N |
| Molecular Weight | 816.23 g/mol |
| Exact Mass | 815.54 |
| IUPAC Name | N,N-bis[3-(4-hexylphenyl)-4-methyl-5-(4-methylphenyl)phenyl]-2,4,6-trimethylaniline |
| SMILES | CCCCCCc1ccc(-c2cc(N(c3cc(-c4ccc(C)cc4)c(C)c(-c4ccc(CCCCCC)cc4)c3)c3c(C)cc(C)cc3C)cc(-c3ccc(C)cc3)c2C)cc1 |
| InChI | InChI=1S/C61H69N/c1-10-12-14-16-18-49-24-32-53(33-25-49)59-40-55(38-57(47(59)8)51-28-20-42(3)21-29-51)62(61-45(6)36-44(5)37-46(61)7)56-39-58(52-30-22-43(4)23-31-52)48(9)60(41-56)54-34-26-50(27-35-54)19-17-15-13-11-2/h20-41H,10-19H2,1-9H3 |
| InChIKey | JJYBWVMEDJLCDK-UHFFFAOYSA-N |
| XLogP | 18.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.23 |
| LogP ≤ 5 | 18.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|