C21H29N — CID 138600835
N,2,6-trimethyl-N-(4-methylphenyl)-4-pentylaniline (PubChem CID 138600835) has the molecular formula C21H29N and a molecular weight of 295.47 g/mol. Its IUPAC name is N,2,6-trimethyl-N-(4-methylphenyl)-4-pentylaniline.
| Compound Name | N,2,6-trimethyl-N-(4-methylphenyl)-4-pentylaniline |
|---|---|
| PubChem CID | 138600835 |
| Molecular Formula | C21H29N |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | N,2,6-trimethyl-N-(4-methylphenyl)-4-pentylaniline |
| SMILES | CCCCCc1cc(C)c(N(C)c2ccc(C)cc2)c(C)c1 |
| InChI | InChI=1S/C21H29N/c1-6-7-8-9-19-14-17(3)21(18(4)15-19)22(5)20-12-10-16(2)11-13-20/h10-15H,6-9H2,1-5H3 |
| InChIKey | GCYIQIYVWMDBSA-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|