C56H64N2 — CID 118520725
2-N,7-N-bis(4-butyl-2,6-dimethylphenyl)-2-N,7-N-bis(3,5-dimethylphenyl)-9,10-dimethylphenanthrene-2,7-diamine (PubChem CID 118520725) has the molecular formula C56H64N2 and a molecular weight of 765.14 g/mol. Its IUPAC name is 2-N,7-N-bis(4-butyl-2,6-dimethylphenyl)-2-N,7-N-bis(3,5-dimethylphenyl)-9,10-dimethylphenanthrene-2,7-diamine.
| Compound Name | 2-N,7-N-bis(4-butyl-2,6-dimethylphenyl)-2-N,7-N-bis(3,5-dimethylphenyl)-9,10-dimethylphenanthrene-2,7-diamine |
|---|---|
| PubChem CID | 118520725 |
| Molecular Formula | C56H64N2 |
| Molecular Weight | 765.14 g/mol |
| Exact Mass | 764.51 |
| IUPAC Name | 2-N,7-N-bis(4-butyl-2,6-dimethylphenyl)-2-N,7-N-bis(3,5-dimethylphenyl)-9,10-dimethylphenanthrene-2,7-diamine |
| SMILES | CCCCc1cc(C)c(N(c2cc(C)cc(C)c2)c2ccc3c(c2)c(C)c(C)c2cc(N(c4cc(C)cc(C)c4)c4c(C)cc(CCCC)cc4C)ccc23)c(C)c1 |
| InChI | InChI=1S/C56H64N2/c1-13-15-17-45-29-39(7)55(40(8)30-45)57(49-25-35(3)23-36(4)26-49)47-19-21-51-52-22-20-48(34-54(52)44(12)43(11)53(51)33-47)58(50-27-37(5)24-38(6)28-50)56-41(9)31-46(18-16-14-2)32-42(56)10/h19-34H,13-18H2,1-12H3 |
| InChIKey | URLHOHLHRFGVJY-UHFFFAOYSA-N |
| XLogP | 16.70 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.14 |
| LogP ≤ 5 | 16.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|