C56H70N2 — CID 145173333
2-N-(2,6-dimethyl-4-pentylphenyl)-2-N,6-N-bis[4-(3-methylpentan-3-yl)phenyl]-6-N-(2,4,6-trimethylphenyl)naphthalene-2,6-diamine (PubChem CID 145173333) has the molecular formula C56H70N2 and a molecular weight of 771.19 g/mol. Its IUPAC name is 2-N-(2,6-dimethyl-4-pentylphenyl)-2-N,6-N-bis[4-(3-methylpentan-3-yl)phenyl]-6-N-(2,4,6-trimethylphenyl)naphthalene-2,6-diamine.
| Compound Name | 2-N-(2,6-dimethyl-4-pentylphenyl)-2-N,6-N-bis[4-(3-methylpentan-3-yl)phenyl]-6-N-(2,4,6-trimethylphenyl)naphthalene-2,6-diamine |
|---|---|
| PubChem CID | 145173333 |
| Molecular Formula | C56H70N2 |
| Molecular Weight | 771.19 g/mol |
| Exact Mass | 770.55 |
| IUPAC Name | 2-N-(2,6-dimethyl-4-pentylphenyl)-2-N,6-N-bis[4-(3-methylpentan-3-yl)phenyl]-6-N-(2,4,6-trimethylphenyl)naphthalene-2,6-diamine |
| SMILES | CCCCCc1cc(C)c(N(c2ccc(C(C)(CC)CC)cc2)c2ccc3cc(N(c4ccc(C(C)(CC)CC)cc4)c4c(C)cc(C)cc4C)ccc3c2)c(C)c1 |
| InChI | InChI=1S/C56H70N2/c1-13-18-19-20-44-35-42(9)54(43(10)36-44)58(50-31-25-48(26-32-50)56(12,16-4)17-5)52-28-22-45-37-51(27-21-46(45)38-52)57(53-40(7)33-39(6)34-41(53)8)49-29-23-47(24-30-49)55(11,14-2)15-3/h21-38H,13-20H2,1-12H3 |
| InChIKey | JKFHEHKYABNHAP-UHFFFAOYSA-N |
| XLogP | 17.21 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.19 |
| LogP ≤ 5 | 17.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|