C56H60Br2N2 — CID 118655597
4-N,11-N-bis(4-bromophenyl)-4-N,11-N-bis(4-butyl-2,6-dimethylphenyl)pentacyclo[12.3.3.01,14.02,7.08,13]icosa-2(7),3,5,8(13),9,11-hexaene-4,11-diamine (PubChem CID 118655597) has the molecular formula C56H60Br2N2 and a molecular weight of 920.92 g/mol. Its IUPAC name is 4-N,11-N-bis(4-bromophenyl)-4-N,11-N-bis(4-butyl-2,6-dimethylphenyl)pentacyclo[12.3.3.01,14.02,7.08,13]icosa-2(7),3,5,8(13),9,11-hexaene-4,11-diamine.
| Compound Name | 4-N,11-N-bis(4-bromophenyl)-4-N,11-N-bis(4-butyl-2,6-dimethylphenyl)pentacyclo[12.3.3.01,14.02,7.08,13]icosa-2(7),3,5,8(13),9,11-hexaene-4,11-diamine |
|---|---|
| PubChem CID | 118655597 |
| Molecular Formula | C56H60Br2N2 |
| Molecular Weight | 920.92 g/mol |
| Exact Mass | 918.31 |
| IUPAC Name | 4-N,11-N-bis(4-bromophenyl)-4-N,11-N-bis(4-butyl-2,6-dimethylphenyl)pentacyclo[12.3.3.01,14.02,7.08,13]icosa-2(7),3,5,8(13),9,11-hexaene-4,11-diamine |
| SMILES | CCCCc1cc(C)c(N(c2ccc(Br)cc2)c2ccc3c(c2)C24CCCC2(CCC4)c2cc(N(c4ccc(Br)cc4)c4c(C)cc(CCCC)cc4C)ccc2-3)c(C)c1 |
| InChI | InChI=1S/C56H60Br2N2/c1-7-9-13-41-31-37(3)53(38(4)32-41)59(45-19-15-43(57)16-20-45)47-23-25-49-50-26-24-48(36-52(50)56-29-11-27-55(56,28-12-30-56)51(49)35-47)60(46-21-17-44(58)18-22-46)54-39(5)33-42(14-10-8-2)34-40(54)6/h15-26,31-36H,7-14,27-30H2,1-6H3 |
| InChIKey | JDNNUASATFTEKB-UHFFFAOYSA-N |
| XLogP | 17.59 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 920.92 |
| LogP ≤ 5 | 17.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |