C32H31NS2 — CID 59682229
4-butyl-N,N-bis[4-(5-methylthiophen-2-yl)phenyl]aniline (PubChem CID 59682229) has the molecular formula C32H31NS2 and a molecular weight of 493.74 g/mol. Its IUPAC name is 4-butyl-N,N-bis[4-(5-methylthiophen-2-yl)phenyl]aniline.
| Compound Name | 4-butyl-N,N-bis[4-(5-methylthiophen-2-yl)phenyl]aniline |
|---|---|
| PubChem CID | 59682229 |
| Molecular Formula | C32H31NS2 |
| Molecular Weight | 493.74 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | 4-butyl-N,N-bis[4-(5-methylthiophen-2-yl)phenyl]aniline |
| SMILES | CCCCc1ccc(N(c2ccc(-c3ccc(C)s3)cc2)c2ccc(-c3ccc(C)s3)cc2)cc1 |
| InChI | InChI=1S/C32H31NS2/c1-4-5-6-25-9-15-28(16-10-25)33(29-17-11-26(12-18-29)31-21-7-23(2)34-31)30-19-13-27(14-20-30)32-22-8-24(3)35-32/h7-22H,4-6H2,1-3H3 |
| InChIKey | SWYWEGBFUHOHRJ-UHFFFAOYSA-N |
| XLogP | 10.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.74 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |