C46H46N2S3 — CID 122204785
2,4,6-tris[5-(4-butylphenyl)thiophen-2-yl]pyrimidine (PubChem CID 122204785) has the molecular formula C46H46N2S3 and a molecular weight of 723.09 g/mol. Its IUPAC name is 2,4,6-tris[5-(4-butylphenyl)thiophen-2-yl]pyrimidine.
| Compound Name | 2,4,6-tris[5-(4-butylphenyl)thiophen-2-yl]pyrimidine |
|---|---|
| PubChem CID | 122204785 |
| Molecular Formula | C46H46N2S3 |
| Molecular Weight | 723.09 g/mol |
| Exact Mass | 722.28 |
| IUPAC Name | 2,4,6-tris[5-(4-butylphenyl)thiophen-2-yl]pyrimidine |
| SMILES | CCCCc1ccc(-c2ccc(-c3cc(-c4ccc(-c5ccc(CCCC)cc5)s4)nc(-c4ccc(-c5ccc(CCCC)cc5)s4)n3)s2)cc1 |
| InChI | InChI=1S/C46H46N2S3/c1-4-7-10-32-13-19-35(20-14-32)40-25-28-43(49-40)38-31-39(44-29-26-41(50-44)36-21-15-33(16-22-36)11-8-5-2)48-46(47-38)45-30-27-42(51-45)37-23-17-34(18-24-37)12-9-6-3/h13-31H,4-12H2,1-3H3 |
| InChIKey | OZLALTAJIZSSHQ-UHFFFAOYSA-N |
| XLogP | 14.69 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.09 |
| LogP ≤ 5 | 14.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |