C34H26F4N4O2S4 — CID 134195678
2,8-bis[5-[4-(1,1-difluorobutoxy)phenyl]thiophen-2-yl]-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaene (PubChem CID 134195678) has the molecular formula C34H26F4N4O2S4 and a molecular weight of 726.87 g/mol. Its IUPAC name is 2,8-bis[5-[4-(1,1-difluorobutoxy)phenyl]thiophen-2-yl]-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaene.
| Compound Name | 2,8-bis[5-[4-(1,1-difluorobutoxy)phenyl]thiophen-2-yl]-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaene |
|---|---|
| PubChem CID | 134195678 |
| Molecular Formula | C34H26F4N4O2S4 |
| Molecular Weight | 726.87 g/mol |
| Exact Mass | 726.09 |
| IUPAC Name | 2,8-bis[5-[4-(1,1-difluorobutoxy)phenyl]thiophen-2-yl]-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaene |
| SMILES | CCCC(F)(F)Oc1ccc(-c2ccc(-c3c4c(c(-c5ccc(-c6ccc(OC(F)(F)CCC)cc6)s5)c5nsnc35)N=S=N4)s2)cc1 |
| InChI | InChI=1S/C34H26F4N4O2S4/c1-3-17-33(35,36)43-21-9-5-19(6-10-21)23-13-15-25(45-23)27-29-31(41-47-39-29)28(32-30(27)40-48-42-32)26-16-14-24(46-26)20-7-11-22(12-8-20)44-34(37,38)18-4-2/h5-16H,3-4,17-18H2,1-2H3 |
| InChIKey | LONRXFMFILFZBY-UHFFFAOYSA-N |
| XLogP | 12.75 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.87 |
| LogP ≤ 5 | 12.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |