C36H28F4N4O2S3 — CID 134536202
4-[5-[4-(1,1-difluorobutoxy)phenyl]thiophen-2-yl]-9-[5-[4-(1,1-difluoroethoxy)phenyl]thiophen-2-yl]-6,7-dimethyl-[1,2,5]thiadiazolo[3,4-g]quinoxaline (PubChem CID 134536202) has the molecular formula C36H28F4N4O2S3 and a molecular weight of 720.84 g/mol. Its IUPAC name is 4-[5-[4-(1,1-difluorobutoxy)phenyl]thiophen-2-yl]-9-[5-[4-(1,1-difluoroethoxy)phenyl]thiophen-2-yl]-6,7-dimethyl-[1,2,5]thiadiazolo[3,4-g]quinoxaline.
| Compound Name | 4-[5-[4-(1,1-difluorobutoxy)phenyl]thiophen-2-yl]-9-[5-[4-(1,1-difluoroethoxy)phenyl]thiophen-2-yl]-6,7-dimethyl-[1,2,5]thiadiazolo[3,4-g]quinoxaline |
|---|---|
| PubChem CID | 134536202 |
| Molecular Formula | C36H28F4N4O2S3 |
| Molecular Weight | 720.84 g/mol |
| Exact Mass | 720.13 |
| IUPAC Name | 4-[5-[4-(1,1-difluorobutoxy)phenyl]thiophen-2-yl]-9-[5-[4-(1,1-difluoroethoxy)phenyl]thiophen-2-yl]-6,7-dimethyl-[1,2,5]thiadiazolo[3,4-g]quinoxaline |
| SMILES | CCCC(F)(F)Oc1ccc(-c2ccc(-c3c4nsnc4c(-c4ccc(-c5ccc(OC(C)(F)F)cc5)s4)c4nc(C)c(C)nc34)s2)cc1 |
| InChI | InChI=1S/C36H28F4N4O2S3/c1-5-18-36(39,40)46-24-12-8-22(9-13-24)26-15-17-28(48-26)30-32-31(41-19(2)20(3)42-32)29(33-34(30)44-49-43-33)27-16-14-25(47-27)21-6-10-23(11-7-21)45-35(4,37)38/h6-17H,5,18H2,1-4H3 |
| InChIKey | ZRHKIOYMIUHHEP-UHFFFAOYSA-N |
| XLogP | 11.81 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.84 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |