C34H30F4N2O2S3 — CID 146230983
7-[2-[4-(1,1-difluorobutoxy)phenyl]-2,3-dihydrothiophen-5-yl]-4-[5-[4-(1,1-difluorobutoxy)phenyl]thiophen-2-yl]-2,1,3-benzothiadiazole (PubChem CID 146230983) has the molecular formula C34H30F4N2O2S3 and a molecular weight of 670.82 g/mol. Its IUPAC name is 7-[2-[4-(1,1-difluorobutoxy)phenyl]-2,3-dihydrothiophen-5-yl]-4-[5-[4-(1,1-difluorobutoxy)phenyl]thiophen-2-yl]-2,1,3-benzothiadiazole.
| Compound Name | 7-[2-[4-(1,1-difluorobutoxy)phenyl]-2,3-dihydrothiophen-5-yl]-4-[5-[4-(1,1-difluorobutoxy)phenyl]thiophen-2-yl]-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 146230983 |
| Molecular Formula | C34H30F4N2O2S3 |
| Molecular Weight | 670.82 g/mol |
| Exact Mass | 670.14 |
| IUPAC Name | 7-[2-[4-(1,1-difluorobutoxy)phenyl]-2,3-dihydrothiophen-5-yl]-4-[5-[4-(1,1-difluorobutoxy)phenyl]thiophen-2-yl]-2,1,3-benzothiadiazole |
| SMILES | CCCC(F)(F)Oc1ccc(-c2ccc(-c3ccc(C4=CCC(c5ccc(OC(F)(F)CCC)cc5)S4)c4nsnc34)s2)cc1 |
| InChI | InChI=1S/C34H30F4N2O2S3/c1-3-19-33(35,36)41-23-9-5-21(6-10-23)27-15-17-29(43-27)25-13-14-26(32-31(25)39-45-40-32)30-18-16-28(44-30)22-7-11-24(12-8-22)42-34(37,38)20-4-2/h5-15,17-18,28H,3-4,16,19-20H2,1-2H3 |
| InChIKey | SZAGIBIRYYHIHU-UHFFFAOYSA-N |
| XLogP | 11.85 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.82 |
| LogP ≤ 5 | 11.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |