C40H39F3N4OS4 — CID 122547730
2-[5-(4-hexyl-3-methylphenyl)thiophen-2-yl]-8-[5-[4-hexyl-3-(trifluoromethoxy)phenyl]thiophen-2-yl]-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaene (PubChem CID 122547730) has the molecular formula C40H39F3N4OS4 and a molecular weight of 777.04 g/mol. Its IUPAC name is 2-[5-(4-hexyl-3-methylphenyl)thiophen-2-yl]-8-[5-[4-hexyl-3-(trifluoromethoxy)phenyl]thiophen-2-yl]-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaene.
| Compound Name | 2-[5-(4-hexyl-3-methylphenyl)thiophen-2-yl]-8-[5-[4-hexyl-3-(trifluoromethoxy)phenyl]thiophen-2-yl]-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaene |
|---|---|
| PubChem CID | 122547730 |
| Molecular Formula | C40H39F3N4OS4 |
| Molecular Weight | 777.04 g/mol |
| Exact Mass | 776.20 |
| IUPAC Name | 2-[5-(4-hexyl-3-methylphenyl)thiophen-2-yl]-8-[5-[4-hexyl-3-(trifluoromethoxy)phenyl]thiophen-2-yl]-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaene |
| SMILES | CCCCCCc1ccc(-c2ccc(-c3c4c(c(-c5ccc(-c6ccc(CCCCCC)c(OC(F)(F)F)c6)s5)c5nsnc35)N=S=N4)s2)cc1C |
| InChI | InChI=1S/C40H39F3N4OS4/c1-4-6-8-10-12-25-14-16-27(22-24(25)3)30-18-20-32(49-30)34-36-38(46-51-44-36)35(39-37(34)45-52-47-39)33-21-19-31(50-33)28-17-15-26(13-11-9-7-5-2)29(23-28)48-40(41,42)43/h14-23H,4-13H2,1-3H3 |
| InChIKey | DDPAEOUZPCYKOH-UHFFFAOYSA-N |
| XLogP | 14.66 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.04 |
| LogP ≤ 5 | 14.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|