C44H46N6O2S4 — CID 137167433
4-[5-[8-[5-(4-cyano-3-octoxyphenyl)thiophen-2-yl]-5,7-dihydro-[1,2,5]thiadiazolo[3,4-f][2,1,3]benzothiadiazol-4-yl]thiophen-2-yl]-2-octoxybenzonitrile (PubChem CID 137167433) has the molecular formula C44H46N6O2S4 and a molecular weight of 819.16 g/mol. Its IUPAC name is 4-[5-[8-[5-(4-cyano-3-octoxyphenyl)thiophen-2-yl]-5,7-dihydro-[1,2,5]thiadiazolo[3,4-f][2,1,3]benzothiadiazol-4-yl]thiophen-2-yl]-2-octoxybenzonitrile.
| Compound Name | 4-[5-[8-[5-(4-cyano-3-octoxyphenyl)thiophen-2-yl]-5,7-dihydro-[1,2,5]thiadiazolo[3,4-f][2,1,3]benzothiadiazol-4-yl]thiophen-2-yl]-2-octoxybenzonitrile |
|---|---|
| PubChem CID | 137167433 |
| Molecular Formula | C44H46N6O2S4 |
| Molecular Weight | 819.16 g/mol |
| Exact Mass | 818.26 |
| IUPAC Name | 4-[5-[8-[5-(4-cyano-3-octoxyphenyl)thiophen-2-yl]-5,7-dihydro-[1,2,5]thiadiazolo[3,4-f][2,1,3]benzothiadiazol-4-yl]thiophen-2-yl]-2-octoxybenzonitrile |
| SMILES | CCCCCCCCOc1cc(-c2ccc(-c3c4c(c(-c5ccc(-c6ccc(C#N)c(OCCCCCCCC)c6)s5)c5nsnc35)NSN4)s2)ccc1C#N |
| InChI | InChI=1S/C44H46N6O2S4/c1-3-5-7-9-11-13-23-51-33-25-29(15-17-31(33)27-45)35-19-21-37(53-35)39-41-43(49-55-47-41)40(44-42(39)48-56-50-44)38-22-20-36(54-38)30-16-18-32(28-46)34(26-30)52-24-14-12-10-8-6-4-2/h15-22,25-26,47,49H,3-14,23-24H2,1-2H3 |
| InChIKey | BIAVZCDFMUJXBY-UHFFFAOYSA-N |
| XLogP | 14.10 |
| TPSA | 115.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.16 |
| LogP ≤ 5 | 14.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|