C44H46F6N4S4 — CID 137167438
4,8-bis[5-[4-octyl-3-(trifluoromethyl)phenyl]thiophen-2-yl]-5,7-dihydro-[1,2,5]thiadiazolo[3,4-f][2,1,3]benzothiadiazole (PubChem CID 137167438) has the molecular formula C44H46F6N4S4 and a molecular weight of 873.14 g/mol. Its IUPAC name is 4,8-bis[5-[4-octyl-3-(trifluoromethyl)phenyl]thiophen-2-yl]-5,7-dihydro-[1,2,5]thiadiazolo[3,4-f][2,1,3]benzothiadiazole.
| Compound Name | 4,8-bis[5-[4-octyl-3-(trifluoromethyl)phenyl]thiophen-2-yl]-5,7-dihydro-[1,2,5]thiadiazolo[3,4-f][2,1,3]benzothiadiazole |
|---|---|
| PubChem CID | 137167438 |
| Molecular Formula | C44H46F6N4S4 |
| Molecular Weight | 873.14 g/mol |
| Exact Mass | 872.25 |
| IUPAC Name | 4,8-bis[5-[4-octyl-3-(trifluoromethyl)phenyl]thiophen-2-yl]-5,7-dihydro-[1,2,5]thiadiazolo[3,4-f][2,1,3]benzothiadiazole |
| SMILES | CCCCCCCCc1ccc(-c2ccc(-c3c4c(c(-c5ccc(-c6ccc(CCCCCCCC)c(C(F)(F)F)c6)s5)c5nsnc35)NSN4)s2)cc1C(F)(F)F |
| InChI | InChI=1S/C44H46F6N4S4/c1-3-5-7-9-11-13-15-27-17-19-29(25-31(27)43(45,46)47)33-21-23-35(55-33)37-39-41(53-57-51-39)38(42-40(37)52-58-54-42)36-24-22-34(56-36)30-20-18-28(32(26-30)44(48,49)50)16-14-12-10-8-6-4-2/h17-26,51,53H,3-16H2,1-2H3 |
| InChIKey | GWZJEHZZPJUNKV-UHFFFAOYSA-N |
| XLogP | 16.73 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.14 |
| LogP ≤ 5 | 16.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|