C28H10F6N6O4S6 — CID 122549927
2,8-bis[5-[4-nitro-3-(trifluoromethylsulfanyl)phenyl]thiophen-2-yl]-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaene (PubChem CID 122549927) has the molecular formula C28H10F6N6O4S6 and a molecular weight of 800.82 g/mol. Its IUPAC name is 2,8-bis[5-[4-nitro-3-(trifluoromethylsulfanyl)phenyl]thiophen-2-yl]-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaene.
| Compound Name | 2,8-bis[5-[4-nitro-3-(trifluoromethylsulfanyl)phenyl]thiophen-2-yl]-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaene |
|---|---|
| PubChem CID | 122549927 |
| Molecular Formula | C28H10F6N6O4S6 |
| Molecular Weight | 800.82 g/mol |
| Exact Mass | 799.90 |
| IUPAC Name | 2,8-bis[5-[4-nitro-3-(trifluoromethylsulfanyl)phenyl]thiophen-2-yl]-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaene |
| SMILES | O=[N+]([O-])c1ccc(-c2ccc(-c3c4c(c(-c5ccc(-c6ccc([N+](=O)[O-])c(SC(F)(F)F)c6)s5)c5nsnc35)N=S=N4)s2)cc1SC(F)(F)F |
| InChI | InChI=1S/C28H10F6N6O4S6/c29-27(30,31)47-19-9-11(1-3-13(19)39(41)42)15-5-7-17(45-15)21-23-25(37-49-35-23)22(26-24(21)36-50-38-26)18-8-6-16(46-18)12-2-4-14(40(43)44)20(10-12)48-28(32,33)34/h1-10H |
| InChIKey | WSLBSBHZZLBMKO-UHFFFAOYSA-N |
| XLogP | 12.25 |
| TPSA | 136.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.82 |
| LogP ≤ 5 | 12.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|