C14H17F3N2O3S — CID 21312324
2,3-dimethyl-N-[4-nitro-3-(trifluoromethylsulfanyl)phenyl]pentanamide (PubChem CID 21312324) has the molecular formula C14H17F3N2O3S and a molecular weight of 350.36 g/mol. Its IUPAC name is 2,3-dimethyl-N-[4-nitro-3-(trifluoromethylsulfanyl)phenyl]pentanamide.
| Compound Name | 2,3-dimethyl-N-[4-nitro-3-(trifluoromethylsulfanyl)phenyl]pentanamide |
|---|---|
| PubChem CID | 21312324 |
| Molecular Formula | C14H17F3N2O3S |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 2,3-dimethyl-N-[4-nitro-3-(trifluoromethylsulfanyl)phenyl]pentanamide |
| SMILES | CCC(C)C(C)C(=O)Nc1ccc([N+](=O)[O-])c(SC(F)(F)F)c1 |
| InChI | InChI=1S/C14H17F3N2O3S/c1-4-8(2)9(3)13(20)18-10-5-6-11(19(21)22)12(7-10)23-14(15,16)17/h5-9H,4H2,1-3H3,(H,18,20) |
| InChIKey | XYORETSLVLBARM-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|