C31H32FN3S2 — CID 146533190
4-[4-[5-[4-(3-ethylheptyl)-2-fluorophenyl]thiophen-2-yl]-2,1,3-benzothiadiazol-7-yl]aniline (PubChem CID 146533190) has the molecular formula C31H32FN3S2 and a molecular weight of 529.75 g/mol. Its IUPAC name is 4-[4-[5-[4-(3-ethylheptyl)-2-fluorophenyl]thiophen-2-yl]-2,1,3-benzothiadiazol-7-yl]aniline.
| Compound Name | 4-[4-[5-[4-(3-ethylheptyl)-2-fluorophenyl]thiophen-2-yl]-2,1,3-benzothiadiazol-7-yl]aniline |
|---|---|
| PubChem CID | 146533190 |
| Molecular Formula | C31H32FN3S2 |
| Molecular Weight | 529.75 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | 4-[4-[5-[4-(3-ethylheptyl)-2-fluorophenyl]thiophen-2-yl]-2,1,3-benzothiadiazol-7-yl]aniline |
| SMILES | CCCCC(CC)CCc1ccc(-c2ccc(-c3ccc(-c4ccc(N)cc4)c4nsnc34)s2)c(F)c1 |
| InChI | InChI=1S/C31H32FN3S2/c1-3-5-6-20(4-2)7-8-21-9-14-25(27(32)19-21)28-17-18-29(36-28)26-16-15-24(30-31(26)35-37-34-30)22-10-12-23(33)13-11-22/h9-20H,3-8,33H2,1-2H3 |
| InChIKey | KIFDRECYGQUKBD-UHFFFAOYSA-N |
| XLogP | 9.62 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.75 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|