C44H51FN6S3 — CID 146534068
[4-(3-ethylheptyl)-2-fluorophenyl]-[5-[7-[5-[[4-(3-ethylheptyl)phenyl]diazenyl]thiophen-2-yl]-2,1,3-benzothiadiazol-4-yl]thiophen-2-yl]diazene (PubChem CID 146534068) has the molecular formula C44H51FN6S3 and a molecular weight of 779.13 g/mol. Its IUPAC name is [4-(3-ethylheptyl)-2-fluorophenyl]-[5-[7-[5-[[4-(3-ethylheptyl)phenyl]diazenyl]thiophen-2-yl]-2,1,3-benzothiadiazol-4-yl]thiophen-2-yl]diazene.
| Compound Name | [4-(3-ethylheptyl)-2-fluorophenyl]-[5-[7-[5-[[4-(3-ethylheptyl)phenyl]diazenyl]thiophen-2-yl]-2,1,3-benzothiadiazol-4-yl]thiophen-2-yl]diazene |
|---|---|
| PubChem CID | 146534068 |
| Molecular Formula | C44H51FN6S3 |
| Molecular Weight | 779.13 g/mol |
| Exact Mass | 778.33 |
| IUPAC Name | [4-(3-ethylheptyl)-2-fluorophenyl]-[5-[7-[5-[[4-(3-ethylheptyl)phenyl]diazenyl]thiophen-2-yl]-2,1,3-benzothiadiazol-4-yl]thiophen-2-yl]diazene |
| SMILES | CCCCC(CC)CCc1ccc(/N=N/c2ccc(-c3ccc(-c4ccc(/N=N/c5ccc(CCC(CC)CCCC)cc5F)s4)c4nsnc34)s2)cc1 |
| InChI | InChI=1S/C44H51FN6S3/c1-5-9-11-30(7-3)13-15-32-17-20-34(21-18-32)46-48-41-27-25-39(52-41)35-22-23-36(44-43(35)50-54-51-44)40-26-28-42(53-40)49-47-38-24-19-33(29-37(38)45)16-14-31(8-4)12-10-6-2/h17-31H,5-16H2,1-4H3/b48-46+,49-47+ |
| InChIKey | JYAZBGKPHCLAIU-ROHDNENLSA-N |
| XLogP | 16.42 |
| TPSA | 75.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.13 |
| LogP ≤ 5 | 16.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|