C50H54N6O2S — CID 146454489
[4-(2-ethylhexoxy)naphthalen-1-yl]-[4-[7-[4-[[4-(2-ethylhexoxy)phenyl]diazenyl]phenyl]-2,1,3-benzothiadiazol-4-yl]phenyl]diazene (PubChem CID 146454489) has the molecular formula C50H54N6O2S and a molecular weight of 803.09 g/mol. Its IUPAC name is [4-(2-ethylhexoxy)naphthalen-1-yl]-[4-[7-[4-[[4-(2-ethylhexoxy)phenyl]diazenyl]phenyl]-2,1,3-benzothiadiazol-4-yl]phenyl]diazene.
| Compound Name | [4-(2-ethylhexoxy)naphthalen-1-yl]-[4-[7-[4-[[4-(2-ethylhexoxy)phenyl]diazenyl]phenyl]-2,1,3-benzothiadiazol-4-yl]phenyl]diazene |
|---|---|
| PubChem CID | 146454489 |
| Molecular Formula | C50H54N6O2S |
| Molecular Weight | 803.09 g/mol |
| Exact Mass | 802.40 |
| IUPAC Name | [4-(2-ethylhexoxy)naphthalen-1-yl]-[4-[7-[4-[[4-(2-ethylhexoxy)phenyl]diazenyl]phenyl]-2,1,3-benzothiadiazol-4-yl]phenyl]diazene |
| SMILES | CCCCC(CC)COc1ccc(/N=N/c2ccc(-c3ccc(-c4ccc(/N=N/c5ccc(OCC(CC)CCCC)c6ccccc56)cc4)c4nsnc34)cc2)cc1 |
| InChI | InChI=1S/C50H54N6O2S/c1-5-9-13-35(7-3)33-57-42-27-25-41(26-28-42)52-51-39-21-17-37(18-22-39)43-29-30-44(50-49(43)55-59-56-50)38-19-23-40(24-20-38)53-54-47-31-32-48(46-16-12-11-15-45(46)47)58-34-36(8-4)14-10-6-2/h11-12,15-32,35-36H,5-10,13-14,33-34H2,1-4H3/b52-51+,54-53+ |
| InChIKey | KLHYDSOYJNLAOB-FHBCWKJKSA-N |
| XLogP | 16.20 |
| TPSA | 93.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.09 |
| LogP ≤ 5 | 16.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|