C31H38BFN2O2S2 — CID 164934075
4-[5-[4-(3-ethylheptyl)-2-fluorophenyl]thiophen-2-yl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,1,3-benzothiadiazole (PubChem CID 164934075) has the molecular formula C31H38BFN2O2S2 and a molecular weight of 564.60 g/mol. Its IUPAC name is 4-[5-[4-(3-ethylheptyl)-2-fluorophenyl]thiophen-2-yl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,1,3-benzothiadiazole.
| Compound Name | 4-[5-[4-(3-ethylheptyl)-2-fluorophenyl]thiophen-2-yl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 164934075 |
| Molecular Formula | C31H38BFN2O2S2 |
| Molecular Weight | 564.60 g/mol |
| Exact Mass | 564.25 |
| IUPAC Name | 4-[5-[4-(3-ethylheptyl)-2-fluorophenyl]thiophen-2-yl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,1,3-benzothiadiazole |
| SMILES | CCCCC(CC)CCc1ccc(-c2ccc(-c3ccc(B4OC(C)(C)C(C)(C)O4)c4nsnc34)s2)c(F)c1 |
| InChI | InChI=1S/C31H38BFN2O2S2/c1-7-9-10-20(8-2)11-12-21-13-14-22(25(33)19-21)26-17-18-27(38-26)23-15-16-24(29-28(23)34-39-35-29)32-36-30(3,4)31(5,6)37-32/h13-20H,7-12H2,1-6H3 |
| InChIKey | YYOYSFBBGBDJSP-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.60 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|