C54H62F2N4S — CID 122680084
6,7-diethyl-4,9-bis[4-[4-(2-ethylheptyl)-2-fluorophenyl]phenyl]-[1,2,5]thiadiazolo[3,4-g]quinoxaline (PubChem CID 122680084) has the molecular formula C54H62F2N4S and a molecular weight of 837.18 g/mol. Its IUPAC name is 6,7-diethyl-4,9-bis[4-[4-(2-ethylheptyl)-2-fluorophenyl]phenyl]-[1,2,5]thiadiazolo[3,4-g]quinoxaline.
| Compound Name | 6,7-diethyl-4,9-bis[4-[4-(2-ethylheptyl)-2-fluorophenyl]phenyl]-[1,2,5]thiadiazolo[3,4-g]quinoxaline |
|---|---|
| PubChem CID | 122680084 |
| Molecular Formula | C54H62F2N4S |
| Molecular Weight | 837.18 g/mol |
| Exact Mass | 836.47 |
| IUPAC Name | 6,7-diethyl-4,9-bis[4-[4-(2-ethylheptyl)-2-fluorophenyl]phenyl]-[1,2,5]thiadiazolo[3,4-g]quinoxaline |
| SMILES | CCCCCC(CC)Cc1ccc(-c2ccc(-c3c4nsnc4c(-c4ccc(-c5ccc(CC(CC)CCCCC)cc5F)cc4)c4nc(CC)c(CC)nc34)cc2)c(F)c1 |
| InChI | InChI=1S/C54H62F2N4S/c1-7-13-15-17-35(9-3)31-37-19-29-43(45(55)33-37)39-21-25-41(26-22-39)49-51-52(58-48(12-6)47(11-5)57-51)50(54-53(49)59-61-60-54)42-27-23-40(24-28-42)44-30-20-38(34-46(44)56)32-36(10-4)18-16-14-8-2/h19-30,33-36H,7-18,31-32H2,1-6H3 |
| InChIKey | QMKCOXVVJGRWJH-UHFFFAOYSA-N |
| XLogP | 16.00 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.18 |
| LogP ≤ 5 | 16.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|