C38H45N3O2S — CID 155033054
(E)-3-[4-[4-[3,5-bis(2-ethylhexyl)phenyl]-2,1,3-benzothiadiazol-7-yl]phenyl]-2-cyanoprop-2-enoic acid (PubChem CID 155033054) has the molecular formula C38H45N3O2S and a molecular weight of 607.86 g/mol. Its IUPAC name is (E)-3-[4-[4-[3,5-bis(2-ethylhexyl)phenyl]-2,1,3-benzothiadiazol-7-yl]phenyl]-2-cyanoprop-2-enoic acid.
| Compound Name | (E)-3-[4-[4-[3,5-bis(2-ethylhexyl)phenyl]-2,1,3-benzothiadiazol-7-yl]phenyl]-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 155033054 |
| Molecular Formula | C38H45N3O2S |
| Molecular Weight | 607.86 g/mol |
| Exact Mass | 607.32 |
| IUPAC Name | (E)-3-[4-[4-[3,5-bis(2-ethylhexyl)phenyl]-2,1,3-benzothiadiazol-7-yl]phenyl]-2-cyanoprop-2-enoic acid |
| SMILES | CCCCC(CC)Cc1cc(CC(CC)CCCC)cc(-c2ccc(-c3ccc(/C=C(\C#N)C(=O)O)cc3)c3nsnc23)c1 |
| InChI | InChI=1S/C38H45N3O2S/c1-5-9-11-26(7-3)19-29-21-30(20-27(8-4)12-10-6-2)24-32(23-29)35-18-17-34(36-37(35)41-44-40-36)31-15-13-28(14-16-31)22-33(25-39)38(42)43/h13-18,21-24,26-27H,5-12,19-20H2,1-4H3,(H,42,43)/b33-22+ |
| InChIKey | SZZFNQAEHXBXMN-STKMKYKTSA-N |
| XLogP | 10.53 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.86 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|