C32H33N3OS — CID 160776201
(2E)-3-oxo-2-[[4-[4-[2,4,6-tri(propan-2-yl)phenyl]-2,1,3-benzothiadiazol-7-yl]phenyl]methylidene]butanenitrile (PubChem CID 160776201) has the molecular formula C32H33N3OS and a molecular weight of 507.70 g/mol. Its IUPAC name is (2E)-3-oxo-2-[[4-[4-[2,4,6-tri(propan-2-yl)phenyl]-2,1,3-benzothiadiazol-7-yl]phenyl]methylidene]butanenitrile.
| Compound Name | (2E)-3-oxo-2-[[4-[4-[2,4,6-tri(propan-2-yl)phenyl]-2,1,3-benzothiadiazol-7-yl]phenyl]methylidene]butanenitrile |
|---|---|
| PubChem CID | 160776201 |
| Molecular Formula | C32H33N3OS |
| Molecular Weight | 507.70 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | (2E)-3-oxo-2-[[4-[4-[2,4,6-tri(propan-2-yl)phenyl]-2,1,3-benzothiadiazol-7-yl]phenyl]methylidene]butanenitrile |
| SMILES | CC(=O)/C(C#N)=C/c1ccc(-c2ccc(-c3c(C(C)C)cc(C(C)C)cc3C(C)C)c3nsnc23)cc1 |
| InChI | InChI=1S/C32H33N3OS/c1-18(2)24-15-28(19(3)4)30(29(16-24)20(5)6)27-13-12-26(31-32(27)35-37-34-31)23-10-8-22(9-11-23)14-25(17-33)21(7)36/h8-16,18-20H,1-7H3/b25-14+ |
| InChIKey | BGKAWRWJSKEYKY-AFUMVMLFSA-N |
| XLogP | 8.89 |
| TPSA | 66.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.70 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|