C34H40N6O4S3 — CID 145018073
2-[5,6-diamino-4-[5-(2-ethylhexyl)-4,6-dioxothieno[2,3-c]pyrrol-2-yl]-2,1,3-benzothiadiazol-7-yl]-5-(2-ethylhexyl)thieno[2,3-c]pyrrole-4,6-dione (PubChem CID 145018073) has the molecular formula C34H40N6O4S3 and a molecular weight of 692.93 g/mol. Its IUPAC name is 2-[5,6-diamino-4-[5-(2-ethylhexyl)-4,6-dioxothieno[2,3-c]pyrrol-2-yl]-2,1,3-benzothiadiazol-7-yl]-5-(2-ethylhexyl)thieno[2,3-c]pyrrole-4,6-dione.
| Compound Name | 2-[5,6-diamino-4-[5-(2-ethylhexyl)-4,6-dioxothieno[2,3-c]pyrrol-2-yl]-2,1,3-benzothiadiazol-7-yl]-5-(2-ethylhexyl)thieno[2,3-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 145018073 |
| Molecular Formula | C34H40N6O4S3 |
| Molecular Weight | 692.93 g/mol |
| Exact Mass | 692.23 |
| IUPAC Name | 2-[5,6-diamino-4-[5-(2-ethylhexyl)-4,6-dioxothieno[2,3-c]pyrrol-2-yl]-2,1,3-benzothiadiazol-7-yl]-5-(2-ethylhexyl)thieno[2,3-c]pyrrole-4,6-dione |
| SMILES | CCCCC(CC)CN1C(=O)c2cc(-c3c(N)c(N)c(-c4cc5c(s4)C(=O)N(CC(CC)CCCC)C5=O)c4nsnc34)sc2C1=O |
| InChI | InChI=1S/C34H40N6O4S3/c1-5-9-11-17(7-3)15-39-31(41)19-13-21(45-29(19)33(39)43)23-25(35)26(36)24(28-27(23)37-47-38-28)22-14-20-30(46-22)34(44)40(32(20)42)16-18(8-4)12-10-6-2/h13-14,17-18H,5-12,15-16,35-36H2,1-4H3 |
| InChIKey | FBXRURVNCKYEBQ-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 152.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.93 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|