C54H63Br2N3O4S2 — CID 122366350
5,9-bis(5-bromothiophen-2-yl)-7-(2-ethylhexyl)-2,3-bis(3-octoxyphenyl)pyrrolo[3,4-g]quinoxaline-6,8-dione (PubChem CID 122366350) has the molecular formula C54H63Br2N3O4S2 and a molecular weight of 1042.06 g/mol. Its IUPAC name is 5,9-bis(5-bromothiophen-2-yl)-7-(2-ethylhexyl)-2,3-bis(3-octoxyphenyl)pyrrolo[3,4-g]quinoxaline-6,8-dione.
| Compound Name | 5,9-bis(5-bromothiophen-2-yl)-7-(2-ethylhexyl)-2,3-bis(3-octoxyphenyl)pyrrolo[3,4-g]quinoxaline-6,8-dione |
|---|---|
| PubChem CID | 122366350 |
| Molecular Formula | C54H63Br2N3O4S2 |
| Molecular Weight | 1042.06 g/mol |
| Exact Mass | 1039.26 |
| IUPAC Name | 5,9-bis(5-bromothiophen-2-yl)-7-(2-ethylhexyl)-2,3-bis(3-octoxyphenyl)pyrrolo[3,4-g]quinoxaline-6,8-dione |
| SMILES | CCCCCCCCOc1cccc(-c2nc3c(-c4ccc(Br)s4)c4c(c(-c5ccc(Br)s5)c3nc2-c2cccc(OCCCCCCCC)c2)C(=O)N(CC(CC)CCCC)C4=O)c1 |
| InChI | InChI=1S/C54H63Br2N3O4S2/c1-5-9-12-14-16-18-31-62-39-25-20-23-37(33-39)49-50(38-24-21-26-40(34-38)63-32-19-17-15-13-10-6-2)58-52-46(42-28-30-44(56)65-42)48-47(45(51(52)57-49)41-27-29-43(55)64-41)53(60)59(54(48)61)35-36(8-4)22-11-7-3/h20-21,23-30,33-34,36H,5-19,22,31-32,35H2,1-4H3 |
| InChIKey | OPMQKMVIHZNXMJ-UHFFFAOYSA-N |
| XLogP | 17.24 |
| TPSA | 81.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1042.06 |
| LogP ≤ 5 | 17.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|