C34H42Br2N2O2S — CID 142727421
5,7-dibromo-2,3-bis(3-octoxyphenyl)thieno[3,4-b]pyrazine (PubChem CID 142727421) has the molecular formula C34H42Br2N2O2S and a molecular weight of 702.60 g/mol. Its IUPAC name is 5,7-dibromo-2,3-bis(3-octoxyphenyl)thieno[3,4-b]pyrazine.
| Compound Name | 5,7-dibromo-2,3-bis(3-octoxyphenyl)thieno[3,4-b]pyrazine |
|---|---|
| PubChem CID | 142727421 |
| Molecular Formula | C34H42Br2N2O2S |
| Molecular Weight | 702.60 g/mol |
| Exact Mass | 700.13 |
| IUPAC Name | 5,7-dibromo-2,3-bis(3-octoxyphenyl)thieno[3,4-b]pyrazine |
| SMILES | CCCCCCCCOc1cccc(-c2nc3c(Br)sc(Br)c3nc2-c2cccc(OCCCCCCCC)c2)c1 |
| InChI | InChI=1S/C34H42Br2N2O2S/c1-3-5-7-9-11-13-21-39-27-19-15-17-25(23-27)29-30(38-32-31(37-29)33(35)41-34(32)36)26-18-16-20-28(24-26)40-22-14-12-10-8-6-4-2/h15-20,23-24H,3-14,21-22H2,1-2H3 |
| InChIKey | ZTOJLRUMQHHJKE-UHFFFAOYSA-N |
| XLogP | 12.03 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.60 |
| LogP ≤ 5 | 12.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|