C20H27N3O3S2 — CID 88552255
7-(3-aminopropylamino)-6-(benzenecarbonothioylsulfanyl)-4-cyano-4,6-dimethyl-7-oxoheptanoic acid (PubChem CID 88552255) has the molecular formula C20H27N3O3S2 and a molecular weight of 421.59 g/mol. Its IUPAC name is 7-(3-aminopropylamino)-6-(benzenecarbonothioylsulfanyl)-4-cyano-4,6-dimethyl-7-oxoheptanoic acid.
| Compound Name | 7-(3-aminopropylamino)-6-(benzenecarbonothioylsulfanyl)-4-cyano-4,6-dimethyl-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 88552255 |
| Molecular Formula | C20H27N3O3S2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 7-(3-aminopropylamino)-6-(benzenecarbonothioylsulfanyl)-4-cyano-4,6-dimethyl-7-oxoheptanoic acid |
| SMILES | CC(C#N)(CCC(=O)O)CC(C)(SC(=S)c1ccccc1)C(=O)NCCCN |
| InChI | InChI=1S/C20H27N3O3S2/c1-19(14-22,10-9-16(24)25)13-20(2,18(26)23-12-6-11-21)28-17(27)15-7-4-3-5-8-15/h3-5,7-8H,6,9-13,21H2,1-2H3,(H,23,26)(H,24,25) |
| InChIKey | PMLBHVRVOKTFQJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 116.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|